C22H27ClN5O8PS — CID 153359001
1-[[(2S,3S,4R,5R)-5-[6-chloro-4-(2,3-dihydro-1H-inden-1-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]propylphosphonic acid (PubChem CID 153359001) has the molecular formula C22H27ClN5O8PS and a molecular weight of 587.98 g/mol. Its IUPAC name is 1-[[(2S,3S,4R,5R)-5-[6-chloro-4-(2,3-dihydro-1H-inden-1-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]propylphosphonic acid.
| Compound Name | 1-[[(2S,3S,4R,5R)-5-[6-chloro-4-(2,3-dihydro-1H-inden-1-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]propylphosphonic acid |
|---|---|
| PubChem CID | 153359001 |
| Molecular Formula | C22H27ClN5O8PS |
| Molecular Weight | 587.98 g/mol |
| Exact Mass | 587.10 |
| IUPAC Name | 1-[[(2S,3S,4R,5R)-5-[6-chloro-4-(2,3-dihydro-1H-inden-1-ylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonyl]propylphosphonic acid |
| SMILES | CCC(P(=O)(O)O)S(=O)(=O)C[C@H]1O[C@@H](n2ncc3c(NC4CCc5ccccc54)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H27ClN5O8PS/c1-2-16(37(31,32)33)38(34,35)10-15-17(29)18(30)21(36-15)28-20-13(9-24-28)19(26-22(23)27-20)25-14-8-7-11-5-3-4-6-12(11)14/h3-6,9,14-18,21,29-30H,2,7-8,10H2,1H3,(H,25,26,27)(H2,31,32,33)/t14?,15-,16?,17-,18-,21-/m1/s1 |
| InChIKey | WYARBDJGMJITOY-AOLCQSGOSA-N |
| XLogP | 1.53 |
| TPSA | 196.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.98 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|