C24H36ClN4O8P — CID 153359037
[2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-morpholin-4-ylpropan-2-yl]phosphonic acid (PubChem CID 153359037) has the molecular formula C24H36ClN4O8P and a molecular weight of 575.00 g/mol. Its IUPAC name is [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-morpholin-4-ylpropan-2-yl]phosphonic acid.
| Compound Name | [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-morpholin-4-ylpropan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 153359037 |
| Molecular Formula | C24H36ClN4O8P |
| Molecular Weight | 575.00 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | [2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrrolo[2,3-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-morpholin-4-ylpropan-2-yl]phosphonic acid |
| SMILES | CC(CN1CCOCC1)(OC[C@H]1O[C@@H](n2ccc3c(NC4CCCC4)cc(Cl)nc32)[C@H](O)[C@@H]1O)P(=O)(O)O |
| InChI | InChI=1S/C24H36ClN4O8P/c1-24(38(32,33)34,14-28-8-10-35-11-9-28)36-13-18-20(30)21(31)23(37-18)29-7-6-16-17(12-19(25)27-22(16)29)26-15-4-2-3-5-15/h6-7,12,15,18,20-21,23,30-31H,2-5,8-11,13-14H2,1H3,(H,26,27)(H2,32,33,34)/t18-,20-,21-,23-,24?/m1/s1 |
| InChIKey | UTQVTUAXOGGLSQ-UHDYJPHVSA-N |
| XLogP | 1.91 |
| TPSA | 158.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.00 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|