C22H27ClN5O7P — CID 153359067
[(1R)-1-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopropylmethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phenylethyl]phosphonic acid (PubChem CID 153359067) has the molecular formula C22H27ClN5O7P and a molecular weight of 539.91 g/mol. Its IUPAC name is [(1R)-1-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopropylmethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phenylethyl]phosphonic acid.
| Compound Name | [(1R)-1-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopropylmethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phenylethyl]phosphonic acid |
|---|---|
| PubChem CID | 153359067 |
| Molecular Formula | C22H27ClN5O7P |
| Molecular Weight | 539.91 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | [(1R)-1-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopropylmethylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-2-phenylethyl]phosphonic acid |
| SMILES | O=P(O)(O)[C@H](Cc1ccccc1)OC[C@H]1O[C@@H](n2ncc3c(NCC4CC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H27ClN5O7P/c23-22-26-19(24-9-13-6-7-13)14-10-25-28(20(14)27-22)21-18(30)17(29)15(35-21)11-34-16(36(31,32)33)8-12-4-2-1-3-5-12/h1-5,10,13,15-18,21,29-30H,6-9,11H2,(H,24,26,27)(H2,31,32,33)/t15-,16-,17-,18-,21-/m1/s1 |
| InChIKey | QKWBZIVFDSTNGL-PDOZGGDVSA-N |
| XLogP | 1.68 |
| TPSA | 172.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.91 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|