C20H30ClN4O8PS — CID 153359116
[(2S,3S,4R,5R)-5-[6-chloro-4-[(2-propan-2-ylcyclopentyl)amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid (PubChem CID 153359116) has the molecular formula C20H30ClN4O8PS and a molecular weight of 552.97 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[6-chloro-4-[(2-propan-2-ylcyclopentyl)amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid.
| Compound Name | [(2S,3S,4R,5R)-5-[6-chloro-4-[(2-propan-2-ylcyclopentyl)amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 153359116 |
| Molecular Formula | C20H30ClN4O8PS |
| Molecular Weight | 552.97 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[6-chloro-4-[(2-propan-2-ylcyclopentyl)amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
| SMILES | CC(C)C1CCCC1Nc1cc(Cl)nc2c1cnn2[C@@H]1O[C@H](CS(=O)(=O)CP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H30ClN4O8PS/c1-10(2)11-4-3-5-13(11)23-14-6-16(21)24-19-12(14)7-22-25(19)20-18(27)17(26)15(33-20)8-35(31,32)9-34(28,29)30/h6-7,10-11,13,15,17-18,20,26-27H,3-5,8-9H2,1-2H3,(H,23,24)(H2,28,29,30)/t11?,13?,15-,17-,18-,20-/m1/s1 |
| InChIKey | BWTVAFMLWAVRGU-VYOIFHPQSA-N |
| XLogP | 1.49 |
| TPSA | 184.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.97 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|