C25H33ClN5O9P — CID 153359119
[(2R)-2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-3-phenylmethoxypropan-2-yl]phosphonic acid (PubChem CID 153359119) has the molecular formula C25H33ClN5O9P and a molecular weight of 613.99 g/mol. Its IUPAC name is [(2R)-2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-3-phenylmethoxypropan-2-yl]phosphonic acid.
| Compound Name | [(2R)-2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-3-phenylmethoxypropan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 153359119 |
| Molecular Formula | C25H33ClN5O9P |
| Molecular Weight | 613.99 g/mol |
| Exact Mass | 613.17 |
| IUPAC Name | [(2R)-2-[[(2R,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy]-1-hydroxy-3-phenylmethoxypropan-2-yl]phosphonic acid |
| SMILES | O=P(O)(O)[C@](CO)(COCc1ccccc1)OC[C@H]1O[C@@H](n2ncc3c(NC4CCCC4)nc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H33ClN5O9P/c26-24-29-21(28-16-8-4-5-9-16)17-10-27-31(22(17)30-24)23-20(34)19(33)18(40-23)12-39-25(13-32,41(35,36)37)14-38-11-15-6-2-1-3-7-15/h1-3,6-7,10,16,18-20,23,32-34H,4-5,8-9,11-14H2,(H,28,29,30)(H2,35,36,37)/t18-,19-,20-,23-,25-/m1/s1 |
| InChIKey | IGUAZBDGKDJVAL-VPQQHZGJSA-N |
| XLogP | 1.55 |
| TPSA | 201.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.99 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|