C23H28ClFN5O6P — CID 153359164
[1-[[(2R,3R,4S,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-phenylethyl]phosphonic acid (PubChem CID 153359164) has the molecular formula C23H28ClFN5O6P and a molecular weight of 555.93 g/mol. Its IUPAC name is [1-[[(2R,3R,4S,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-phenylethyl]phosphonic acid.
| Compound Name | [1-[[(2R,3R,4S,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-phenylethyl]phosphonic acid |
|---|---|
| PubChem CID | 153359164 |
| Molecular Formula | C23H28ClFN5O6P |
| Molecular Weight | 555.93 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | [1-[[(2R,3R,4S,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[3,4-d]pyrimidin-1-yl]-4-fluoro-3-hydroxyoxolan-2-yl]methoxy]-2-phenylethyl]phosphonic acid |
| SMILES | O=P(O)(O)C(Cc1ccccc1)OC[C@H]1O[C@@H](n2ncc3c(NC4CCCC4)nc(Cl)nc32)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C23H28ClFN5O6P/c24-23-28-20(27-14-8-4-5-9-14)15-11-26-30(21(15)29-23)22-18(25)19(31)16(36-22)12-35-17(37(32,33)34)10-13-6-2-1-3-7-13/h1-3,6-7,11,14,16-19,22,31H,4-5,8-10,12H2,(H,27,28,29)(H2,32,33,34)/t16-,17?,18+,19-,22-/m1/s1 |
| InChIKey | PJNXIOXEJNXFGX-ALJCFLIJSA-N |
| XLogP | 3.19 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.93 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|