C21H19F3N4O2 — CID 153359249
[(3aR,6aS)-5-[2-(trifluoromethoxy)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-imidazo[1,2-a]pyrimidin-2-ylmethanone (PubChem CID 153359249) has the molecular formula C21H19F3N4O2 and a molecular weight of 416.40 g/mol. Its IUPAC name is [(3aR,6aS)-5-[2-(trifluoromethoxy)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-imidazo[1,2-a]pyrimidin-2-ylmethanone.
| Compound Name | [(3aR,6aS)-5-[2-(trifluoromethoxy)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-imidazo[1,2-a]pyrimidin-2-ylmethanone |
|---|---|
| PubChem CID | 153359249 |
| Molecular Formula | C21H19F3N4O2 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | [(3aR,6aS)-5-[2-(trifluoromethoxy)phenyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-imidazo[1,2-a]pyrimidin-2-ylmethanone |
| SMILES | O=C(c1cn2cccnc2n1)N1C[C@H]2CC(c3ccccc3OC(F)(F)F)C[C@H]2C1 |
| InChI | InChI=1S/C21H19F3N4O2/c22-21(23,24)30-18-5-2-1-4-16(18)13-8-14-10-28(11-15(14)9-13)19(29)17-12-27-7-3-6-25-20(27)26-17/h1-7,12-15H,8-11H2/t13?,14-,15+ |
| InChIKey | GABLBIGWKVMYDW-GOOCMWNKSA-N |
| XLogP | 3.89 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |