About 1,5-dimethyltetrazole;hydrofluoride
1,5-dimethyltetrazole;hydrofluoride (PubChem CID 153359282) has the molecular formula C3H7FN4
and a molecular weight of 118.11 g/mol. Its IUPAC name is 1,5-dimethyltetrazole;hydrofluoride.
Molecular Properties
| Compound Name | 1,5-dimethyltetrazole;hydrofluoride |
| PubChem CID | 153359282 |
| Molecular Formula | C3H7FN4 |
| Molecular Weight | 118.11 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | 1,5-dimethyltetrazole;hydrofluoride |
| SMILES | Cc1nnnn1C.F |
| InChI | InChI=1S/C3H6N4.FH/c1-3-4-5-6-7(3)2;/h1-2H3;1H |
| InChIKey | XFJKZUFPMCHBDN-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.11 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,5-dimethyltetrazole;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyltetrazole;hydrofluoride?
The IUPAC name of 1,5-dimethyltetrazole;hydrofluoride (CID 153359282) is 1,5-dimethyltetrazole;hydrofluoride.
What is the SMILES notation for 1,5-dimethyltetrazole;hydrofluoride?
The canonical SMILES for 1,5-dimethyltetrazole;hydrofluoride is Cc1nnnn1C.F.
What is the InChIKey of 1,5-dimethyltetrazole;hydrofluoride?
The InChIKey is XFJKZUFPMCHBDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N4.FH/c1-3-4-5-6-7(3)2;/h1-2H3;1H.
What are the key properties of 1,5-dimethyltetrazole;hydrofluoride?
1,5-dimethyltetrazole;hydrofluoride has a molecular weight of 118.11 g/mol, XLogP of -0.33, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyltetrazole;hydrofluoride is sourced from PubChem (CID 153359282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).