C24H32N8O2 — CID 153359346
N-[6-[amino(2-methylpropanehydrazonoyl)amino]-2-pyridinyl]-2-methoxy-4-methyl-5-(1-propan-2-ylpyrazol-3-yl)benzamide (PubChem CID 153359346) has the molecular formula C24H32N8O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is N-[6-[amino(2-methylpropanehydrazonoyl)amino]-2-pyridinyl]-2-methoxy-4-methyl-5-(1-propan-2-ylpyrazol-3-yl)benzamide.
| Compound Name | N-[6-[amino(2-methylpropanehydrazonoyl)amino]-2-pyridinyl]-2-methoxy-4-methyl-5-(1-propan-2-ylpyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 153359346 |
| Molecular Formula | C24H32N8O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | N-[6-[amino(2-methylpropanehydrazonoyl)amino]-2-pyridinyl]-2-methoxy-4-methyl-5-(1-propan-2-ylpyrazol-3-yl)benzamide |
| SMILES | COc1cc(C)c(-c2ccn(C(C)C)n2)cc1C(=O)Nc1cccc(N(N)/C(=N\N)C(C)C)n1 |
| InChI | InChI=1S/C24H32N8O2/c1-14(2)23(29-25)32(26)22-9-7-8-21(27-22)28-24(33)18-13-17(16(5)12-20(18)34-6)19-10-11-31(30-19)15(3)4/h7-15H,25-26H2,1-6H3,(H,27,28,33)/b29-23- |
| InChIKey | OABSDXGKGWKGNW-FAJYDZGRSA-N |
| XLogP | 3.70 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|