About 2-propan-2-yl-7H-[1,3]dioxino[5,4-d][1,3]thiazole
2-propan-2-yl-7H-[1,3]dioxino[5,4-d][1,3]thiazole (PubChem CID 153359508) has the molecular formula C8H11NO2S
and a molecular weight of 185.25 g/mol. Its IUPAC name is 2-propan-2-yl-7H-[1,3]dioxino[5,4-d][1,3]thiazole.
Molecular Properties
| Compound Name | 2-propan-2-yl-7H-[1,3]dioxino[5,4-d][1,3]thiazole |
| PubChem CID | 153359508 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 2-propan-2-yl-7H-[1,3]dioxino[5,4-d][1,3]thiazole |
| SMILES | CC(C)c1nc2c(s1)OCOC2 |
| InChI | InChI=1S/C8H11NO2S/c1-5(2)7-9-6-3-10-4-11-8(6)12-7/h5H,3-4H2,1-2H3 |
| InChIKey | JJJOVWNZCSDXBE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-propan-2-yl-7H-[1,3]dioxino[5,4-d][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yl-7H-[1,3]dioxino[5,4-d][1,3]thiazole?
The IUPAC name of 2-propan-2-yl-7H-[1,3]dioxino[5,4-d][1,3]thiazole (CID 153359508) is 2-propan-2-yl-7H-[1,3]dioxino[5,4-d][1,3]thiazole.
What is the SMILES notation for 2-propan-2-yl-7H-[1,3]dioxino[5,4-d][1,3]thiazole?
The canonical SMILES for 2-propan-2-yl-7H-[1,3]dioxino[5,4-d][1,3]thiazole is CC(C)c1nc2c(s1)OCOC2.
What is the InChIKey of 2-propan-2-yl-7H-[1,3]dioxino[5,4-d][1,3]thiazole?
The InChIKey is JJJOVWNZCSDXBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S/c1-5(2)7-9-6-3-10-4-11-8(6)12-7/h5H,3-4H2,1-2H3.
What are the key properties of 2-propan-2-yl-7H-[1,3]dioxino[5,4-d][1,3]thiazole?
2-propan-2-yl-7H-[1,3]dioxino[5,4-d][1,3]thiazole has a molecular weight of 185.25 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yl-7H-[1,3]dioxino[5,4-d][1,3]thiazole is sourced from PubChem (CID 153359508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).