C23H30N2S — CID 153359552
N-[4-(2,2-dimethyl-1,3-dihydroinden-4-yl)but-1-en-2-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-amine (PubChem CID 153359552) has the molecular formula C23H30N2S and a molecular weight of 366.57 g/mol. Its IUPAC name is N-[4-(2,2-dimethyl-1,3-dihydroinden-4-yl)but-1-en-2-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-amine.
| Compound Name | N-[4-(2,2-dimethyl-1,3-dihydroinden-4-yl)but-1-en-2-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-amine |
|---|---|
| PubChem CID | 153359552 |
| Molecular Formula | C23H30N2S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N-[4-(2,2-dimethyl-1,3-dihydroinden-4-yl)but-1-en-2-yl]-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]thiazol-2-amine |
| SMILES | C=C(CCc1cccc2c1CC(C)(C)C2)Nc1nc2c(s1)CCCCC2 |
| InChI | InChI=1S/C23H30N2S/c1-16(24-22-25-20-10-5-4-6-11-21(20)26-22)12-13-17-8-7-9-18-14-23(2,3)15-19(17)18/h7-9H,1,4-6,10-15H2,2-3H3,(H,24,25) |
| InChIKey | AOGTWZFXTODJSY-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |