About tert-butyl carbamate;methyl 5-chloro-3-(2-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboxylate
tert-butyl carbamate;methyl 5-chloro-3-(2-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboxylate (PubChem CID 153359755) has the molecular formula C19H29ClN4O5
and a molecular weight of 428.92 g/mol. Its IUPAC name is tert-butyl carbamate;methyl 5-chloro-3-(2-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl carbamate;methyl 5-chloro-3-(2-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboxylate |
| PubChem CID | 153359755 |
| Molecular Formula | C19H29ClN4O5 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | tert-butyl carbamate;methyl 5-chloro-3-(2-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboxylate |
| SMILES | CC(C)(C)OC(N)=O.COC(=O)c1ncc(Cl)nc1N1CCC2(CCOC2)CC1 |
| InChI | InChI=1S/C14H18ClN3O3.C5H11NO2/c1-20-13(19)11-12(17-10(15)8-16-11)18-5-2-14(3-6-18)4-7-21-9-14;1-5(2,3)8-4(6)7/h8H,2-7,9H2,1H3;1-3H3,(H2,6,7) |
| InChIKey | VHUBDLYZVZRCLL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 116.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze tert-butyl carbamate;methyl 5-chloro-3-(2-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl carbamate;methyl 5-chloro-3-(2-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboxylate?
The IUPAC name of tert-butyl carbamate;methyl 5-chloro-3-(2-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboxylate (CID 153359755) is tert-butyl carbamate;methyl 5-chloro-3-(2-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboxylate.
What is the SMILES notation for tert-butyl carbamate;methyl 5-chloro-3-(2-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboxylate?
The canonical SMILES for tert-butyl carbamate;methyl 5-chloro-3-(2-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboxylate is CC(C)(C)OC(N)=O.COC(=O)c1ncc(Cl)nc1N1CCC2(CCOC2)CC1.
What is the InChIKey of tert-butyl carbamate;methyl 5-chloro-3-(2-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboxylate?
The InChIKey is VHUBDLYZVZRCLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClN3O3.C5H11NO2/c1-20-13(19)11-12(17-10(15)8-16-11)18-5-2-14(3-6-18)4-7-21-9-14;1-5(2,3)8-4(6)7/h8H,2-7,9H2,1H3;1-3H3,(H2,6,7).
What are the key properties of tert-butyl carbamate;methyl 5-chloro-3-(2-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboxylate?
tert-butyl carbamate;methyl 5-chloro-3-(2-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboxylate has a molecular weight of 428.92 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl carbamate;methyl 5-chloro-3-(2-oxa-8-azaspiro[4.5]decan-8-yl)pyrazine-2-carboxylate is sourced from PubChem (CID 153359755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).