About ethyl (3Z,5E)-6-ethylsulfanyl-4-fluoro-3-methylhepta-3,5-dienoate
ethyl (3Z,5E)-6-ethylsulfanyl-4-fluoro-3-methylhepta-3,5-dienoate (PubChem CID 153360314) has the molecular formula C12H19FO2S
and a molecular weight of 246.35 g/mol. Its IUPAC name is ethyl (3Z,5E)-6-ethylsulfanyl-4-fluoro-3-methylhepta-3,5-dienoate.
Molecular Properties
| Compound Name | ethyl (3Z,5E)-6-ethylsulfanyl-4-fluoro-3-methylhepta-3,5-dienoate |
| PubChem CID | 153360314 |
| Molecular Formula | C12H19FO2S |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | ethyl (3Z,5E)-6-ethylsulfanyl-4-fluoro-3-methylhepta-3,5-dienoate |
| SMILES | CCOC(=O)C/C(C)=C(F)/C=C(\C)SCC |
| InChI | InChI=1S/C12H19FO2S/c1-5-15-12(14)7-9(3)11(13)8-10(4)16-6-2/h8H,5-7H2,1-4H3/b10-8+,11-9- |
| InChIKey | DSJFXANRZGWKHN-GOOGBFEESA-N |
| XLogP | 3.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3Z,5E)-6-ethylsulfanyl-4-fluoro-3-methylhepta-3,5-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3Z,5E)-6-ethylsulfanyl-4-fluoro-3-methylhepta-3,5-dienoate?
The IUPAC name of ethyl (3Z,5E)-6-ethylsulfanyl-4-fluoro-3-methylhepta-3,5-dienoate (CID 153360314) is ethyl (3Z,5E)-6-ethylsulfanyl-4-fluoro-3-methylhepta-3,5-dienoate.
What is the SMILES notation for ethyl (3Z,5E)-6-ethylsulfanyl-4-fluoro-3-methylhepta-3,5-dienoate?
The canonical SMILES for ethyl (3Z,5E)-6-ethylsulfanyl-4-fluoro-3-methylhepta-3,5-dienoate is CCOC(=O)C/C(C)=C(F)/C=C(\C)SCC.
What is the InChIKey of ethyl (3Z,5E)-6-ethylsulfanyl-4-fluoro-3-methylhepta-3,5-dienoate?
The InChIKey is DSJFXANRZGWKHN-GOOGBFEESA-N. The full InChI is InChI=1S/C12H19FO2S/c1-5-15-12(14)7-9(3)11(13)8-10(4)16-6-2/h8H,5-7H2,1-4H3/b10-8+,11-9-.
What are the key properties of ethyl (3Z,5E)-6-ethylsulfanyl-4-fluoro-3-methylhepta-3,5-dienoate?
ethyl (3Z,5E)-6-ethylsulfanyl-4-fluoro-3-methylhepta-3,5-dienoate has a molecular weight of 246.35 g/mol, XLogP of 3.84, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3Z,5E)-6-ethylsulfanyl-4-fluoro-3-methylhepta-3,5-dienoate is sourced from PubChem (CID 153360314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).