C11H13Cl2F2N3 — CID 153360369
3,5-dichloro-4-(4,4-difluoropiperidin-1-yl)benzene-1,2-diamine (PubChem CID 153360369) has the molecular formula C11H13Cl2F2N3 and a molecular weight of 296.15 g/mol. Its IUPAC name is 3,5-dichloro-4-(4,4-difluoropiperidin-1-yl)benzene-1,2-diamine.
| Compound Name | 3,5-dichloro-4-(4,4-difluoropiperidin-1-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 153360369 |
| Molecular Formula | C11H13Cl2F2N3 |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 3,5-dichloro-4-(4,4-difluoropiperidin-1-yl)benzene-1,2-diamine |
| SMILES | Nc1cc(Cl)c(N2CCC(F)(F)CC2)c(Cl)c1N |
| InChI | InChI=1S/C11H13Cl2F2N3/c12-6-5-7(16)9(17)8(13)10(6)18-3-1-11(14,15)2-4-18/h5H,1-4,16-17H2 |
| InChIKey | BAENBKVCMUDXJK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|