About 4-(1-propanoyl-2,3-dihydroindol-5-yl)-N-(1H-pyrazol-4-ylmethyl)benzamide
4-(1-propanoyl-2,3-dihydroindol-5-yl)-N-(1H-pyrazol-4-ylmethyl)benzamide (PubChem CID 153360602) has the molecular formula C22H22N4O2
and a molecular weight of 374.44 g/mol. Its IUPAC name is 4-(1-propanoyl-2,3-dihydroindol-5-yl)-N-(1H-pyrazol-4-ylmethyl)benzamide.
Molecular Properties
| Compound Name | 4-(1-propanoyl-2,3-dihydroindol-5-yl)-N-(1H-pyrazol-4-ylmethyl)benzamide |
| PubChem CID | 153360602 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 4-(1-propanoyl-2,3-dihydroindol-5-yl)-N-(1H-pyrazol-4-ylmethyl)benzamide |
| SMILES | CCC(=O)N1CCc2cc(-c3ccc(C(=O)NCc4cn[nH]c4)cc3)ccc21 |
| InChI | InChI=1S/C22H22N4O2/c1-2-21(27)26-10-9-19-11-18(7-8-20(19)26)16-3-5-17(6-4-16)22(28)23-12-15-13-24-25-14-15/h3-8,11,13-14H,2,9-10,12H2,1H3,(H,23,28)(H,24,25) |
| InChIKey | NYPMIDRLEKMZDX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1-propanoyl-2,3-dihydroindol-5-yl)-N-(1H-pyrazol-4-ylmethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-propanoyl-2,3-dihydroindol-5-yl)-N-(1H-pyrazol-4-ylmethyl)benzamide?
The IUPAC name of 4-(1-propanoyl-2,3-dihydroindol-5-yl)-N-(1H-pyrazol-4-ylmethyl)benzamide (CID 153360602) is 4-(1-propanoyl-2,3-dihydroindol-5-yl)-N-(1H-pyrazol-4-ylmethyl)benzamide.
What is the SMILES notation for 4-(1-propanoyl-2,3-dihydroindol-5-yl)-N-(1H-pyrazol-4-ylmethyl)benzamide?
The canonical SMILES for 4-(1-propanoyl-2,3-dihydroindol-5-yl)-N-(1H-pyrazol-4-ylmethyl)benzamide is CCC(=O)N1CCc2cc(-c3ccc(C(=O)NCc4cn[nH]c4)cc3)ccc21.
What is the InChIKey of 4-(1-propanoyl-2,3-dihydroindol-5-yl)-N-(1H-pyrazol-4-ylmethyl)benzamide?
The InChIKey is NYPMIDRLEKMZDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O2/c1-2-21(27)26-10-9-19-11-18(7-8-20(19)26)16-3-5-17(6-4-16)22(28)23-12-15-13-24-25-14-15/h3-8,11,13-14H,2,9-10,12H2,1H3,(H,23,28)(H,24,25).
What are the key properties of 4-(1-propanoyl-2,3-dihydroindol-5-yl)-N-(1H-pyrazol-4-ylmethyl)benzamide?
4-(1-propanoyl-2,3-dihydroindol-5-yl)-N-(1H-pyrazol-4-ylmethyl)benzamide has a molecular weight of 374.44 g/mol, XLogP of 3.31, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-propanoyl-2,3-dihydroindol-5-yl)-N-(1H-pyrazol-4-ylmethyl)benzamide is sourced from PubChem (CID 153360602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).