About CID 153361606
CID 153361606 (PubChem CID 153361606) has the molecular formula C11H16BN3
and a molecular weight of 201.08 g/mol.
Molecular Properties
| Compound Name | CID 153361606 |
| PubChem CID | 153361606 |
| Molecular Formula | C11H16BN3 |
| Molecular Weight | 201.08 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(CN2CCN(C)CC2)nc1 |
| InChI | InChI=1S/C11H16BN3/c1-14-4-6-15(7-5-14)9-11-3-2-10(12)8-13-11/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | FZBGVCRLQHSASZ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.08 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 153361606 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153361606?
The IUPAC name of CID 153361606 (CID 153361606) is not available.
What is the SMILES notation for CID 153361606?
The canonical SMILES for CID 153361606 is [B]c1ccc(CN2CCN(C)CC2)nc1.
What is the InChIKey of CID 153361606?
The InChIKey is FZBGVCRLQHSASZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16BN3/c1-14-4-6-15(7-5-14)9-11-3-2-10(12)8-13-11/h2-3,8H,4-7,9H2,1H3.
What are the key properties of CID 153361606?
CID 153361606 has a molecular weight of 201.08 g/mol, XLogP of -0.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153361606 is sourced from PubChem (CID 153361606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).