About (Z)-N-methyl-1-phenylhex-3-en-2-imine;ruthenium(1+)
(Z)-N-methyl-1-phenylhex-3-en-2-imine;ruthenium(1+) (PubChem CID 153361879) has the molecular formula C13H16NRu
and a molecular weight of 287.35 g/mol. Its IUPAC name is (Z)-N-methyl-1-phenylhex-3-en-2-imine;ruthenium(1+).
Molecular Properties
| Compound Name | (Z)-N-methyl-1-phenylhex-3-en-2-imine;ruthenium(1+) |
| PubChem CID | 153361879 |
| Molecular Formula | C13H16NRu |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | (Z)-N-methyl-1-phenylhex-3-en-2-imine;ruthenium(1+) |
| SMILES | CC/C=C\C(Cc1[c-]cccc1)=N/C.[Ru+] |
| InChI | InChI=1S/C13H16N.Ru/c1-3-4-10-13(14-2)11-12-8-6-5-7-9-12;/h4-8,10H,3,11H2,1-2H3;/q-1;+1/b10-4-,14-13+; |
| InChIKey | FJSUZSXSMDSPNV-VBEJFRELSA-N |
| XLogP | 3.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-methyl-1-phenylhex-3-en-2-imine;ruthenium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-methyl-1-phenylhex-3-en-2-imine;ruthenium(1+)?
The IUPAC name of (Z)-N-methyl-1-phenylhex-3-en-2-imine;ruthenium(1+) (CID 153361879) is (Z)-N-methyl-1-phenylhex-3-en-2-imine;ruthenium(1+).
What is the SMILES notation for (Z)-N-methyl-1-phenylhex-3-en-2-imine;ruthenium(1+)?
The canonical SMILES for (Z)-N-methyl-1-phenylhex-3-en-2-imine;ruthenium(1+) is CC/C=C\C(Cc1[c-]cccc1)=N/C.[Ru+].
What is the InChIKey of (Z)-N-methyl-1-phenylhex-3-en-2-imine;ruthenium(1+)?
The InChIKey is FJSUZSXSMDSPNV-VBEJFRELSA-N. The full InChI is InChI=1S/C13H16N.Ru/c1-3-4-10-13(14-2)11-12-8-6-5-7-9-12;/h4-8,10H,3,11H2,1-2H3;/q-1;+1/b10-4-,14-13+;.
What are the key properties of (Z)-N-methyl-1-phenylhex-3-en-2-imine;ruthenium(1+)?
(Z)-N-methyl-1-phenylhex-3-en-2-imine;ruthenium(1+) has a molecular weight of 287.35 g/mol, XLogP of 3.06, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-methyl-1-phenylhex-3-en-2-imine;ruthenium(1+) is sourced from PubChem (CID 153361879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).