About ethane;8-methoxy-7-methylfuro[3,2-c]oxepine-4,6-dione
ethane;8-methoxy-7-methylfuro[3,2-c]oxepine-4,6-dione (PubChem CID 153362051) has the molecular formula C12H14O5
and a molecular weight of 238.24 g/mol. Its IUPAC name is ethane;8-methoxy-7-methylfuro[3,2-c]oxepine-4,6-dione.
Molecular Properties
| Compound Name | ethane;8-methoxy-7-methylfuro[3,2-c]oxepine-4,6-dione |
| PubChem CID | 153362051 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | ethane;8-methoxy-7-methylfuro[3,2-c]oxepine-4,6-dione |
| SMILES | CC.COc1c(C)c(=O)oc(=O)c2ccoc12 |
| InChI | InChI=1S/C10H8O5.C2H6/c1-5-7(13-2)8-6(3-4-14-8)10(12)15-9(5)11;1-2/h3-4H,1-2H3;1-2H3 |
| InChIKey | IEMZVMDRKGABHL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;8-methoxy-7-methylfuro[3,2-c]oxepine-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;8-methoxy-7-methylfuro[3,2-c]oxepine-4,6-dione?
The IUPAC name of ethane;8-methoxy-7-methylfuro[3,2-c]oxepine-4,6-dione (CID 153362051) is ethane;8-methoxy-7-methylfuro[3,2-c]oxepine-4,6-dione.
What is the SMILES notation for ethane;8-methoxy-7-methylfuro[3,2-c]oxepine-4,6-dione?
The canonical SMILES for ethane;8-methoxy-7-methylfuro[3,2-c]oxepine-4,6-dione is CC.COc1c(C)c(=O)oc(=O)c2ccoc12.
What is the InChIKey of ethane;8-methoxy-7-methylfuro[3,2-c]oxepine-4,6-dione?
The InChIKey is IEMZVMDRKGABHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O5.C2H6/c1-5-7(13-2)8-6(3-4-14-8)10(12)15-9(5)11;1-2/h3-4H,1-2H3;1-2H3.
What are the key properties of ethane;8-methoxy-7-methylfuro[3,2-c]oxepine-4,6-dione?
ethane;8-methoxy-7-methylfuro[3,2-c]oxepine-4,6-dione has a molecular weight of 238.24 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;8-methoxy-7-methylfuro[3,2-c]oxepine-4,6-dione is sourced from PubChem (CID 153362051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).