About (2-fluorophenyl) 2-[ethyl-(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate
(2-fluorophenyl) 2-[ethyl-(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate (PubChem CID 153362293) has the molecular formula C16H17FN2O4S
and a molecular weight of 352.39 g/mol. Its IUPAC name is (2-fluorophenyl) 2-[ethyl-(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | (2-fluorophenyl) 2-[ethyl-(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate |
| PubChem CID | 153362293 |
| Molecular Formula | C16H17FN2O4S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (2-fluorophenyl) 2-[ethyl-(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate |
| SMILES | CCN(CCC(=O)OC)c1ncc(C(=O)Oc2ccccc2F)s1 |
| InChI | InChI=1S/C16H17FN2O4S/c1-3-19(9-8-14(20)22-2)16-18-10-13(24-16)15(21)23-12-7-5-4-6-11(12)17/h4-7,10H,3,8-9H2,1-2H3 |
| InChIKey | KBEQWQSGUQRNDS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-fluorophenyl) 2-[ethyl-(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl) 2-[ethyl-(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate?
The IUPAC name of (2-fluorophenyl) 2-[ethyl-(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate (CID 153362293) is (2-fluorophenyl) 2-[ethyl-(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate.
What is the SMILES notation for (2-fluorophenyl) 2-[ethyl-(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate?
The canonical SMILES for (2-fluorophenyl) 2-[ethyl-(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate is CCN(CCC(=O)OC)c1ncc(C(=O)Oc2ccccc2F)s1.
What is the InChIKey of (2-fluorophenyl) 2-[ethyl-(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate?
The InChIKey is KBEQWQSGUQRNDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN2O4S/c1-3-19(9-8-14(20)22-2)16-18-10-13(24-16)15(21)23-12-7-5-4-6-11(12)17/h4-7,10H,3,8-9H2,1-2H3.
What are the key properties of (2-fluorophenyl) 2-[ethyl-(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate?
(2-fluorophenyl) 2-[ethyl-(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate has a molecular weight of 352.39 g/mol, XLogP of 2.89, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl) 2-[ethyl-(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 153362293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).