About N,N-dimethyl-3-(methylideneamino)imidazo[4,5-b]pyridin-7-amine
N,N-dimethyl-3-(methylideneamino)imidazo[4,5-b]pyridin-7-amine (PubChem CID 153362427) has the molecular formula C9H11N5
and a molecular weight of 189.22 g/mol. Its IUPAC name is N,N-dimethyl-3-(methylideneamino)imidazo[4,5-b]pyridin-7-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-3-(methylideneamino)imidazo[4,5-b]pyridin-7-amine |
| PubChem CID | 153362427 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N,N-dimethyl-3-(methylideneamino)imidazo[4,5-b]pyridin-7-amine |
| SMILES | C=Nn1cnc2c(N(C)C)ccnc21 |
| InChI | InChI=1S/C9H11N5/c1-10-14-6-12-8-7(13(2)3)4-5-11-9(8)14/h4-6H,1H2,2-3H3 |
| InChIKey | ZCOGDPVAHYLIKB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-3-(methylideneamino)imidazo[4,5-b]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3-(methylideneamino)imidazo[4,5-b]pyridin-7-amine?
The IUPAC name of N,N-dimethyl-3-(methylideneamino)imidazo[4,5-b]pyridin-7-amine (CID 153362427) is N,N-dimethyl-3-(methylideneamino)imidazo[4,5-b]pyridin-7-amine.
What is the SMILES notation for N,N-dimethyl-3-(methylideneamino)imidazo[4,5-b]pyridin-7-amine?
The canonical SMILES for N,N-dimethyl-3-(methylideneamino)imidazo[4,5-b]pyridin-7-amine is C=Nn1cnc2c(N(C)C)ccnc21.
What is the InChIKey of N,N-dimethyl-3-(methylideneamino)imidazo[4,5-b]pyridin-7-amine?
The InChIKey is ZCOGDPVAHYLIKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5/c1-10-14-6-12-8-7(13(2)3)4-5-11-9(8)14/h4-6H,1H2,2-3H3.
What are the key properties of N,N-dimethyl-3-(methylideneamino)imidazo[4,5-b]pyridin-7-amine?
N,N-dimethyl-3-(methylideneamino)imidazo[4,5-b]pyridin-7-amine has a molecular weight of 189.22 g/mol, XLogP of 0.96, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3-(methylideneamino)imidazo[4,5-b]pyridin-7-amine is sourced from PubChem (CID 153362427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).