C17H21NO — CID 153362630
(1R)-4a,6-dimethylspiro[2,3,4,9,10,10a-hexahydrophenanthrene-1,3'-aziridine]-2'-one (PubChem CID 153362630) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is (1R)-4a,6-dimethylspiro[2,3,4,9,10,10a-hexahydrophenanthrene-1,3'-aziridine]-2'-one.
| Compound Name | (1R)-4a,6-dimethylspiro[2,3,4,9,10,10a-hexahydrophenanthrene-1,3'-aziridine]-2'-one |
|---|---|
| PubChem CID | 153362630 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (1R)-4a,6-dimethylspiro[2,3,4,9,10,10a-hexahydrophenanthrene-1,3'-aziridine]-2'-one |
| SMILES | Cc1ccc2c(c1)C1(C)CCC[C@@]3(NC3=O)C1CC2 |
| InChI | InChI=1S/C17H21NO/c1-11-4-5-12-6-7-14-16(2,13(12)10-11)8-3-9-17(14)15(19)18-17/h4-5,10,14H,3,6-9H2,1-2H3,(H,18,19)/t14?,16?,17-/m1/s1 |
| InChIKey | KRYQBGATOAJSET-BDVYOWHSSA-N |
| XLogP | 2.87 |
| TPSA | 39.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|