C17H22N2O2S — CID 153363145
N-(3-isothiocyanatocyclobutyl)-3-(4-methoxyphenyl)cyclobutane-1-carboxamide;molecular hydrogen (PubChem CID 153363145) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is N-(3-isothiocyanatocyclobutyl)-3-(4-methoxyphenyl)cyclobutane-1-carboxamide;molecular hydrogen.
| Compound Name | N-(3-isothiocyanatocyclobutyl)-3-(4-methoxyphenyl)cyclobutane-1-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 153363145 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-(3-isothiocyanatocyclobutyl)-3-(4-methoxyphenyl)cyclobutane-1-carboxamide;molecular hydrogen |
| SMILES | COc1ccc(C2CC(C(=O)NC3CC(N=C=S)C3)C2)cc1.[H][H] |
| InChI | InChI=1S/C17H20N2O2S.H2/c1-21-16-4-2-11(3-5-16)12-6-13(7-12)17(20)19-15-8-14(9-15)18-10-22;/h2-5,12-15H,6-9H2,1H3,(H,19,20);1H |
| InChIKey | ZOSPXFBZXDEGOW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|