About 3-[1-(2-aminopropanoyl)piperidin-4-yl]-2-methylpyrrole-1-sulfonamide;ethane;formic acid
3-[1-(2-aminopropanoyl)piperidin-4-yl]-2-methylpyrrole-1-sulfonamide;ethane;formic acid (PubChem CID 153363544) has the molecular formula C16H30N4O5S
and a molecular weight of 390.51 g/mol. Its IUPAC name is 3-[1-(2-aminopropanoyl)piperidin-4-yl]-2-methylpyrrole-1-sulfonamide;ethane;formic acid.
Molecular Properties
| Compound Name | 3-[1-(2-aminopropanoyl)piperidin-4-yl]-2-methylpyrrole-1-sulfonamide;ethane;formic acid |
| PubChem CID | 153363544 |
| Molecular Formula | C16H30N4O5S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 3-[1-(2-aminopropanoyl)piperidin-4-yl]-2-methylpyrrole-1-sulfonamide;ethane;formic acid |
| SMILES | CC.Cc1c(C2CCN(C(=O)C(C)N)CC2)ccn1S(N)(=O)=O.O=CO |
| InChI | InChI=1S/C13H22N4O3S.C2H6.CH2O2/c1-9(14)13(18)16-6-3-11(4-7-16)12-5-8-17(10(12)2)21(15,19)20;1-2;2-1-3/h5,8-9,11H,3-4,6-7,14H2,1-2H3,(H2,15,19,20);1-2H3;1H,(H,2,3) |
| InChIKey | BJHPIUOETQZFKV-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 148.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(2-aminopropanoyl)piperidin-4-yl]-2-methylpyrrole-1-sulfonamide;ethane;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2-aminopropanoyl)piperidin-4-yl]-2-methylpyrrole-1-sulfonamide;ethane;formic acid?
The IUPAC name of 3-[1-(2-aminopropanoyl)piperidin-4-yl]-2-methylpyrrole-1-sulfonamide;ethane;formic acid (CID 153363544) is 3-[1-(2-aminopropanoyl)piperidin-4-yl]-2-methylpyrrole-1-sulfonamide;ethane;formic acid.
What is the SMILES notation for 3-[1-(2-aminopropanoyl)piperidin-4-yl]-2-methylpyrrole-1-sulfonamide;ethane;formic acid?
The canonical SMILES for 3-[1-(2-aminopropanoyl)piperidin-4-yl]-2-methylpyrrole-1-sulfonamide;ethane;formic acid is CC.Cc1c(C2CCN(C(=O)C(C)N)CC2)ccn1S(N)(=O)=O.O=CO.
What is the InChIKey of 3-[1-(2-aminopropanoyl)piperidin-4-yl]-2-methylpyrrole-1-sulfonamide;ethane;formic acid?
The InChIKey is BJHPIUOETQZFKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O3S.C2H6.CH2O2/c1-9(14)13(18)16-6-3-11(4-7-16)12-5-8-17(10(12)2)21(15,19)20;1-2;2-1-3/h5,8-9,11H,3-4,6-7,14H2,1-2H3,(H2,15,19,20);1-2H3;1H,(H,2,3).
What are the key properties of 3-[1-(2-aminopropanoyl)piperidin-4-yl]-2-methylpyrrole-1-sulfonamide;ethane;formic acid?
3-[1-(2-aminopropanoyl)piperidin-4-yl]-2-methylpyrrole-1-sulfonamide;ethane;formic acid has a molecular weight of 390.51 g/mol, XLogP of 0.63, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2-aminopropanoyl)piperidin-4-yl]-2-methylpyrrole-1-sulfonamide;ethane;formic acid is sourced from PubChem (CID 153363544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).