About cyclopropane;ethane;1-methyl-N-(4-propan-2-ylphenyl)imidazole-4-sulfonamide
cyclopropane;ethane;1-methyl-N-(4-propan-2-ylphenyl)imidazole-4-sulfonamide (PubChem CID 153363584) has the molecular formula C18H29N3O2S
and a molecular weight of 351.52 g/mol. Its IUPAC name is cyclopropane;ethane;1-methyl-N-(4-propan-2-ylphenyl)imidazole-4-sulfonamide.
Molecular Properties
| Compound Name | cyclopropane;ethane;1-methyl-N-(4-propan-2-ylphenyl)imidazole-4-sulfonamide |
| PubChem CID | 153363584 |
| Molecular Formula | C18H29N3O2S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | cyclopropane;ethane;1-methyl-N-(4-propan-2-ylphenyl)imidazole-4-sulfonamide |
| SMILES | C1CC1.CC.CC(C)c1ccc(NS(=O)(=O)c2cn(C)cn2)cc1 |
| InChI | InChI=1S/C13H17N3O2S.C3H6.C2H6/c1-10(2)11-4-6-12(7-5-11)15-19(17,18)13-8-16(3)9-14-13;1-2-3-1;1-2/h4-10,15H,1-3H3;1-3H2;1-2H3 |
| InChIKey | MLDHIVKZBWTLND-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclopropane;ethane;1-methyl-N-(4-propan-2-ylphenyl)imidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;ethane;1-methyl-N-(4-propan-2-ylphenyl)imidazole-4-sulfonamide?
The IUPAC name of cyclopropane;ethane;1-methyl-N-(4-propan-2-ylphenyl)imidazole-4-sulfonamide (CID 153363584) is cyclopropane;ethane;1-methyl-N-(4-propan-2-ylphenyl)imidazole-4-sulfonamide.
What is the SMILES notation for cyclopropane;ethane;1-methyl-N-(4-propan-2-ylphenyl)imidazole-4-sulfonamide?
The canonical SMILES for cyclopropane;ethane;1-methyl-N-(4-propan-2-ylphenyl)imidazole-4-sulfonamide is C1CC1.CC.CC(C)c1ccc(NS(=O)(=O)c2cn(C)cn2)cc1.
What is the InChIKey of cyclopropane;ethane;1-methyl-N-(4-propan-2-ylphenyl)imidazole-4-sulfonamide?
The InChIKey is MLDHIVKZBWTLND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2S.C3H6.C2H6/c1-10(2)11-4-6-12(7-5-11)15-19(17,18)13-8-16(3)9-14-13;1-2-3-1;1-2/h4-10,15H,1-3H3;1-3H2;1-2H3.
What are the key properties of cyclopropane;ethane;1-methyl-N-(4-propan-2-ylphenyl)imidazole-4-sulfonamide?
cyclopropane;ethane;1-methyl-N-(4-propan-2-ylphenyl)imidazole-4-sulfonamide has a molecular weight of 351.52 g/mol, XLogP of 4.54, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;ethane;1-methyl-N-(4-propan-2-ylphenyl)imidazole-4-sulfonamide is sourced from PubChem (CID 153363584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).