C8H9F6N — CID 153363765
1-[(E)-1,3,3,4,4,4-hexafluorobut-1-en-2-yl]pyrrolidine (PubChem CID 153363765) has the molecular formula C8H9F6N and a molecular weight of 233.15 g/mol. Its IUPAC name is 1-[(E)-1,3,3,4,4,4-hexafluorobut-1-en-2-yl]pyrrolidine.
| Compound Name | 1-[(E)-1,3,3,4,4,4-hexafluorobut-1-en-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 153363765 |
| Molecular Formula | C8H9F6N |
| Molecular Weight | 233.15 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 1-[(E)-1,3,3,4,4,4-hexafluorobut-1-en-2-yl]pyrrolidine |
| SMILES | F/C=C(/N1CCCC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F6N/c9-5-6(15-3-1-2-4-15)7(10,11)8(12,13)14/h5H,1-4H2/b6-5+ |
| InChIKey | UBZHYJYMDGXFIL-AATRIKPKSA-N |
| XLogP | 3.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.15 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|