C9H11F6N — CID 153363768
1-[(E)-2,4,4,5,5,5-hexafluoropent-2-en-3-yl]pyrrolidine (PubChem CID 153363768) has the molecular formula C9H11F6N and a molecular weight of 247.18 g/mol. Its IUPAC name is 1-[(E)-2,4,4,5,5,5-hexafluoropent-2-en-3-yl]pyrrolidine.
| Compound Name | 1-[(E)-2,4,4,5,5,5-hexafluoropent-2-en-3-yl]pyrrolidine |
|---|---|
| PubChem CID | 153363768 |
| Molecular Formula | C9H11F6N |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 1-[(E)-2,4,4,5,5,5-hexafluoropent-2-en-3-yl]pyrrolidine |
| SMILES | C/C(F)=C(\N1CCCC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F6N/c1-6(10)7(16-4-2-3-5-16)8(11,12)9(13,14)15/h2-5H2,1H3/b7-6+ |
| InChIKey | VORGDBNQBJXSJG-VOTSOKGWSA-N |
| XLogP | 3.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|