C26H32FN9O2 — CID 153363995
5-tert-butyl-1,2,4-oxadiazole-3-carbaldehyde;4-[3-fluoro-5-(methylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl]-N-(1-methylpyrazol-3-yl)-1,3,5-triazin-2-amine (PubChem CID 153363995) has the molecular formula C26H32FN9O2 and a molecular weight of 521.60 g/mol. Its IUPAC name is 5-tert-butyl-1,2,4-oxadiazole-3-carbaldehyde;4-[3-fluoro-5-(methylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl]-N-(1-methylpyrazol-3-yl)-1,3,5-triazin-2-amine.
| Compound Name | 5-tert-butyl-1,2,4-oxadiazole-3-carbaldehyde;4-[3-fluoro-5-(methylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl]-N-(1-methylpyrazol-3-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 153363995 |
| Molecular Formula | C26H32FN9O2 |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | 5-tert-butyl-1,2,4-oxadiazole-3-carbaldehyde;4-[3-fluoro-5-(methylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl]-N-(1-methylpyrazol-3-yl)-1,3,5-triazin-2-amine |
| SMILES | CC(C)(C)c1nc(C=O)no1.CNC1CCCCc2cc(-c3ncnc(Nc4ccn(C)n4)n3)c(F)cc21 |
| InChI | InChI=1S/C19H22FN7.C7H10N2O2/c1-21-16-6-4-3-5-12-9-14(15(20)10-13(12)16)18-22-11-23-19(25-18)24-17-7-8-27(2)26-17;1-7(2,3)6-8-5(4-10)9-11-6/h7-11,16,21H,3-6H2,1-2H3,(H,22,23,24,25,26);4H,1-3H3 |
| InChIKey | OKEKCUZZFGDGHB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|