C29H39ClN2O4 — CID 153364307
[(3S,4R)-6-[5-carbamoyl-2-[4-(3-chlorophenyl)butoxy]-N-ethylanilino]-4-ethylhex-1-en-3-yl] acetate (PubChem CID 153364307) has the molecular formula C29H39ClN2O4 and a molecular weight of 515.09 g/mol. Its IUPAC name is [(3S,4R)-6-[5-carbamoyl-2-[4-(3-chlorophenyl)butoxy]-N-ethylanilino]-4-ethylhex-1-en-3-yl] acetate.
| Compound Name | [(3S,4R)-6-[5-carbamoyl-2-[4-(3-chlorophenyl)butoxy]-N-ethylanilino]-4-ethylhex-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 153364307 |
| Molecular Formula | C29H39ClN2O4 |
| Molecular Weight | 515.09 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | [(3S,4R)-6-[5-carbamoyl-2-[4-(3-chlorophenyl)butoxy]-N-ethylanilino]-4-ethylhex-1-en-3-yl] acetate |
| SMILES | C=C[C@H](OC(C)=O)[C@H](CC)CCN(CC)c1cc(C(N)=O)ccc1OCCCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C29H39ClN2O4/c1-5-23(27(6-2)36-21(4)33)16-17-32(7-3)26-20-24(29(31)34)14-15-28(26)35-18-9-8-11-22-12-10-13-25(30)19-22/h6,10,12-15,19-20,23,27H,2,5,7-9,11,16-18H2,1,3-4H3,(H2,31,34)/t23-,27+/m1/s1 |
| InChIKey | UBFMUSRLZNIVTP-KCWPFWIISA-N |
| XLogP | 6.20 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.09 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|