C12H24O4 — CID 153365136
3-methoxy-2,2-dimethyl-6-methylideneoxane;propane-2,2-diol (PubChem CID 153365136) has the molecular formula C12H24O4 and a molecular weight of 232.32 g/mol. Its IUPAC name is 3-methoxy-2,2-dimethyl-6-methylideneoxane;propane-2,2-diol.
| Compound Name | 3-methoxy-2,2-dimethyl-6-methylideneoxane;propane-2,2-diol |
|---|---|
| PubChem CID | 153365136 |
| Molecular Formula | C12H24O4 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 3-methoxy-2,2-dimethyl-6-methylideneoxane;propane-2,2-diol |
| SMILES | C=C1CCC(OC)C(C)(C)O1.CC(C)(O)O |
| InChI | InChI=1S/C9H16O2.C3H8O2/c1-7-5-6-8(10-4)9(2,3)11-7;1-3(2,4)5/h8H,1,5-6H2,2-4H3;4-5H,1-2H3 |
| InChIKey | MMZOTLOYJIRLQP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|