About 4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane;ethane
4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane;ethane (PubChem CID 153365262) has the molecular formula C20H42O
and a molecular weight of 298.56 g/mol. Its IUPAC name is 4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane;ethane.
Molecular Properties
| Compound Name | 4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane;ethane |
| PubChem CID | 153365262 |
| Molecular Formula | C20H42O |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.32 |
| IUPAC Name | 4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane;ethane |
| SMILES | CC.CC.CC1CCC(OC2CCC(C)C(C)C2)CC1C |
| InChI | InChI=1S/C16H30O.2C2H6/c1-11-5-7-15(9-13(11)3)17-16-8-6-12(2)14(4)10-16;2*1-2/h11-16H,5-10H2,1-4H3;2*1-2H3 |
| InChIKey | IWCJMQHMPAZYTM-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane;ethane?
The IUPAC name of 4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane;ethane (CID 153365262) is 4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane;ethane.
What is the SMILES notation for 4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane;ethane?
The canonical SMILES for 4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane;ethane is CC.CC.CC1CCC(OC2CCC(C)C(C)C2)CC1C.
What is the InChIKey of 4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane;ethane?
The InChIKey is IWCJMQHMPAZYTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O.2C2H6/c1-11-5-7-15(9-13(11)3)17-16-8-6-12(2)14(4)10-16;2*1-2/h11-16H,5-10H2,1-4H3;2*1-2H3.
What are the key properties of 4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane;ethane?
4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane;ethane has a molecular weight of 298.56 g/mol, XLogP of 6.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethylcyclohexyl)oxy-1,2-dimethylcyclohexane;ethane is sourced from PubChem (CID 153365262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).