About 2-amino-1-(2,3-dimethoxypropyl)pyrimidin-4-one
2-amino-1-(2,3-dimethoxypropyl)pyrimidin-4-one (PubChem CID 153365654) has the molecular formula C9H15N3O3
and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-amino-1-(2,3-dimethoxypropyl)pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-amino-1-(2,3-dimethoxypropyl)pyrimidin-4-one |
| PubChem CID | 153365654 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 2-amino-1-(2,3-dimethoxypropyl)pyrimidin-4-one |
| SMILES | COCC(Cn1ccc(=O)nc1N)OC |
| InChI | InChI=1S/C9H15N3O3/c1-14-6-7(15-2)5-12-4-3-8(13)11-9(12)10/h3-4,7H,5-6H2,1-2H3,(H2,10,11,13) |
| InChIKey | GUGVFLDCCCDMGC-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-1-(2,3-dimethoxypropyl)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(2,3-dimethoxypropyl)pyrimidin-4-one?
The IUPAC name of 2-amino-1-(2,3-dimethoxypropyl)pyrimidin-4-one (CID 153365654) is 2-amino-1-(2,3-dimethoxypropyl)pyrimidin-4-one.
What is the SMILES notation for 2-amino-1-(2,3-dimethoxypropyl)pyrimidin-4-one?
The canonical SMILES for 2-amino-1-(2,3-dimethoxypropyl)pyrimidin-4-one is COCC(Cn1ccc(=O)nc1N)OC.
What is the InChIKey of 2-amino-1-(2,3-dimethoxypropyl)pyrimidin-4-one?
The InChIKey is GUGVFLDCCCDMGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3/c1-14-6-7(15-2)5-12-4-3-8(13)11-9(12)10/h3-4,7H,5-6H2,1-2H3,(H2,10,11,13).
What are the key properties of 2-amino-1-(2,3-dimethoxypropyl)pyrimidin-4-one?
2-amino-1-(2,3-dimethoxypropyl)pyrimidin-4-one has a molecular weight of 213.24 g/mol, XLogP of -0.51, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(2,3-dimethoxypropyl)pyrimidin-4-one is sourced from PubChem (CID 153365654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).