C22H21FN4O4 — CID 153365975
(3S,6S)-3-[(3-fluorophenyl)methyl]-1,4-dimethyl-6-[(4-nitro-1H-indol-3-yl)methyl]piperazine-2,5-dione (PubChem CID 153365975) has the molecular formula C22H21FN4O4 and a molecular weight of 424.43 g/mol. Its IUPAC name is (3S,6S)-3-[(3-fluorophenyl)methyl]-1,4-dimethyl-6-[(4-nitro-1H-indol-3-yl)methyl]piperazine-2,5-dione.
| Compound Name | (3S,6S)-3-[(3-fluorophenyl)methyl]-1,4-dimethyl-6-[(4-nitro-1H-indol-3-yl)methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 153365975 |
| Molecular Formula | C22H21FN4O4 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (3S,6S)-3-[(3-fluorophenyl)methyl]-1,4-dimethyl-6-[(4-nitro-1H-indol-3-yl)methyl]piperazine-2,5-dione |
| SMILES | CN1C(=O)[C@H](Cc2c[nH]c3cccc([N+](=O)[O-])c23)N(C)C(=O)[C@@H]1Cc1cccc(F)c1 |
| InChI | InChI=1S/C22H21FN4O4/c1-25-18(10-13-5-3-6-15(23)9-13)21(28)26(2)19(22(25)29)11-14-12-24-16-7-4-8-17(20(14)16)27(30)31/h3-9,12,18-19,24H,10-11H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | JTTMVDTYUFJTLJ-OALUTQOASA-N |
| XLogP | 2.67 |
| TPSA | 99.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|