C7H7ClF2N2O — CID 153366257
3-chloro-5-(difluoromethyl)-1-ethylpyrazole-4-carbaldehyde (PubChem CID 153366257) has the molecular formula C7H7ClF2N2O and a molecular weight of 208.59 g/mol. Its IUPAC name is 3-chloro-5-(difluoromethyl)-1-ethylpyrazole-4-carbaldehyde.
| Compound Name | 3-chloro-5-(difluoromethyl)-1-ethylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 153366257 |
| Molecular Formula | C7H7ClF2N2O |
| Molecular Weight | 208.59 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 3-chloro-5-(difluoromethyl)-1-ethylpyrazole-4-carbaldehyde |
| SMILES | CCn1nc(Cl)c(C=O)c1C(F)F |
| InChI | InChI=1S/C7H7ClF2N2O/c1-2-12-5(7(9)10)4(3-13)6(8)11-12/h3,7H,2H2,1H3 |
| InChIKey | XDWATQBJRALDEI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.59 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|