About N-(2-bromo-6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine
N-(2-bromo-6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine (PubChem CID 153366342) has the molecular formula C8H8BrNOS
and a molecular weight of 246.13 g/mol. Its IUPAC name is N-(2-bromo-6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | N-(2-bromo-6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine |
| PubChem CID | 153366342 |
| Molecular Formula | C8H8BrNOS |
| Molecular Weight | 246.13 g/mol |
| Exact Mass | 244.95 |
| IUPAC Name | N-(2-bromo-6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine |
| SMILES | ON=C1CCCc2sc(Br)cc21 |
| InChI | InChI=1S/C8H8BrNOS/c9-8-4-5-6(10-11)2-1-3-7(5)12-8/h4,11H,1-3H2 |
| InChIKey | JAIIWEIZZYUIQI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.13 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromo-6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromo-6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine?
The IUPAC name of N-(2-bromo-6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine (CID 153366342) is N-(2-bromo-6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine.
What is the SMILES notation for N-(2-bromo-6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine?
The canonical SMILES for N-(2-bromo-6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine is ON=C1CCCc2sc(Br)cc21.
What is the InChIKey of N-(2-bromo-6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine?
The InChIKey is JAIIWEIZZYUIQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNOS/c9-8-4-5-6(10-11)2-1-3-7(5)12-8/h4,11H,1-3H2.
What are the key properties of N-(2-bromo-6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine?
N-(2-bromo-6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine has a molecular weight of 246.13 g/mol, XLogP of 3.03, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromo-6,7-dihydro-5H-1-benzothiophen-4-ylidene)hydroxylamine is sourced from PubChem (CID 153366342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).