C16H16O7 — CID 153366545
2,3,5,8-tetrahydroxy-6-methoxy-3-methyl-2,4-dihydro-1H-anthracene-9,10-dione (PubChem CID 153366545) has the molecular formula C16H16O7 and a molecular weight of 320.30 g/mol. Its IUPAC name is 2,3,5,8-tetrahydroxy-6-methoxy-3-methyl-2,4-dihydro-1H-anthracene-9,10-dione.
| Compound Name | 2,3,5,8-tetrahydroxy-6-methoxy-3-methyl-2,4-dihydro-1H-anthracene-9,10-dione |
|---|---|
| PubChem CID | 153366545 |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2,3,5,8-tetrahydroxy-6-methoxy-3-methyl-2,4-dihydro-1H-anthracene-9,10-dione |
| SMILES | COc1cc(O)c2c(c1O)C(=O)C1=C(CC(O)C(C)(O)C1)C2=O |
| InChI | InChI=1S/C16H16O7/c1-16(22)5-7-6(3-10(16)18)13(19)11-8(17)4-9(23-2)15(21)12(11)14(7)20/h4,10,17-18,21-22H,3,5H2,1-2H3 |
| InChIKey | IPVKWDJQQALEDL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|