C28H36ClO9PY — CID 153366589
(E)-3-[3-chloro-4-[2-hydroxy-2-(3-methyl-5-methylidenecyclohexyl)propyl]-2-[(4-phosphonooxyphenyl)methoxy]phenyl]prop-2-enoic acid;methanol;yttrium (PubChem CID 153366589) has the molecular formula C28H36ClO9PY and a molecular weight of 671.92 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-[2-hydroxy-2-(3-methyl-5-methylidenecyclohexyl)propyl]-2-[(4-phosphonooxyphenyl)methoxy]phenyl]prop-2-enoic acid;methanol;yttrium.
| Compound Name | (E)-3-[3-chloro-4-[2-hydroxy-2-(3-methyl-5-methylidenecyclohexyl)propyl]-2-[(4-phosphonooxyphenyl)methoxy]phenyl]prop-2-enoic acid;methanol;yttrium |
|---|---|
| PubChem CID | 153366589 |
| Molecular Formula | C28H36ClO9PY |
| Molecular Weight | 671.92 g/mol |
| Exact Mass | 671.08 |
| IUPAC Name | (E)-3-[3-chloro-4-[2-hydroxy-2-(3-methyl-5-methylidenecyclohexyl)propyl]-2-[(4-phosphonooxyphenyl)methoxy]phenyl]prop-2-enoic acid;methanol;yttrium |
| SMILES | C=C1CC(C)CC(C(C)(O)Cc2ccc(/C=C/C(=O)O)c(OCc3ccc(OP(=O)(O)O)cc3)c2Cl)C1.CO.[Y] |
| InChI | InChI=1S/C27H32ClO8P.CH4O.Y/c1-17-12-18(2)14-22(13-17)27(3,31)15-21-7-6-20(8-11-24(29)30)26(25(21)28)35-16-19-4-9-23(10-5-19)36-37(32,33)34;1-2;/h4-11,18,22,31H,1,12-16H2,2-3H3,(H,29,30)(H2,32,33,34);2H,1H3;/b11-8+;; |
| InChIKey | AQPUFLQSSYNIBN-OHENRDTHSA-N |
| XLogP | 5.38 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.92 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|