C30H35FN4O4S — CID 153366714
3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[(1R)-1-(8-fluoro-1-oxo-4,5-dihydro-3H-1λ4,2-benzothiazepin-2-yl)-7-methyl-2,3-dihydro-1H-inden-4-yl]propanoic acid (PubChem CID 153366714) has the molecular formula C30H35FN4O4S and a molecular weight of 566.70 g/mol. Its IUPAC name is 3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[(1R)-1-(8-fluoro-1-oxo-4,5-dihydro-3H-1λ4,2-benzothiazepin-2-yl)-7-methyl-2,3-dihydro-1H-inden-4-yl]propanoic acid.
| Compound Name | 3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[(1R)-1-(8-fluoro-1-oxo-4,5-dihydro-3H-1λ4,2-benzothiazepin-2-yl)-7-methyl-2,3-dihydro-1H-inden-4-yl]propanoic acid |
|---|---|
| PubChem CID | 153366714 |
| Molecular Formula | C30H35FN4O4S |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | 3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]-3-[(1R)-1-(8-fluoro-1-oxo-4,5-dihydro-3H-1λ4,2-benzothiazepin-2-yl)-7-methyl-2,3-dihydro-1H-inden-4-yl]propanoic acid |
| SMILES | COc1cc(C(CC(=O)O)c2ccc(C)c3c2CC[C@H]3N2CCCc3ccc(F)cc3S2=O)cc(N)c1N(C)N |
| InChI | InChI=1S/C30H35FN4O4S/c1-17-6-9-21(23(16-28(36)37)19-13-24(32)30(34(2)33)26(14-19)39-3)22-10-11-25(29(17)22)35-12-4-5-18-7-8-20(31)15-27(18)40(35)38/h6-9,13-15,23,25H,4-5,10-12,16,32-33H2,1-3H3,(H,36,37)/t23?,25-,40?/m1/s1 |
| InChIKey | XFWBIDZFXLMRFZ-NKDUKBGGSA-N |
| XLogP | 4.60 |
| TPSA | 122.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|