About 5-chloro-1,2-dihydropyridin-6-amine;ethane
5-chloro-1,2-dihydropyridin-6-amine;ethane (PubChem CID 153366774) has the molecular formula C7H13ClN2
and a molecular weight of 160.65 g/mol. Its IUPAC name is 5-chloro-1,2-dihydropyridin-6-amine;ethane.
Molecular Properties
| Compound Name | 5-chloro-1,2-dihydropyridin-6-amine;ethane |
| PubChem CID | 153366774 |
| Molecular Formula | C7H13ClN2 |
| Molecular Weight | 160.65 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 5-chloro-1,2-dihydropyridin-6-amine;ethane |
| SMILES | CC.NC1=C(Cl)C=CCN1 |
| InChI | InChI=1S/C5H7ClN2.C2H6/c6-4-2-1-3-8-5(4)7;1-2/h1-2,8H,3,7H2;1-2H3 |
| InChIKey | HLTHXJJZEMXQMR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.65 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-1,2-dihydropyridin-6-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,2-dihydropyridin-6-amine;ethane?
The IUPAC name of 5-chloro-1,2-dihydropyridin-6-amine;ethane (CID 153366774) is 5-chloro-1,2-dihydropyridin-6-amine;ethane.
What is the SMILES notation for 5-chloro-1,2-dihydropyridin-6-amine;ethane?
The canonical SMILES for 5-chloro-1,2-dihydropyridin-6-amine;ethane is CC.NC1=C(Cl)C=CCN1.
What is the InChIKey of 5-chloro-1,2-dihydropyridin-6-amine;ethane?
The InChIKey is HLTHXJJZEMXQMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN2.C2H6/c6-4-2-1-3-8-5(4)7;1-2/h1-2,8H,3,7H2;1-2H3.
What are the key properties of 5-chloro-1,2-dihydropyridin-6-amine;ethane?
5-chloro-1,2-dihydropyridin-6-amine;ethane has a molecular weight of 160.65 g/mol, XLogP of 1.54, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,2-dihydropyridin-6-amine;ethane is sourced from PubChem (CID 153366774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).