C12H6Cl4F3N7 — CID 153366779
3-chloro-2-[5-(trichloromethyl)-3-[[5-(trifluoromethyl)tetrazol-2-yl]methyl]pyrazol-1-yl]pyridine (PubChem CID 153366779) has the molecular formula C12H6Cl4F3N7 and a molecular weight of 447.04 g/mol. Its IUPAC name is 3-chloro-2-[5-(trichloromethyl)-3-[[5-(trifluoromethyl)tetrazol-2-yl]methyl]pyrazol-1-yl]pyridine.
| Compound Name | 3-chloro-2-[5-(trichloromethyl)-3-[[5-(trifluoromethyl)tetrazol-2-yl]methyl]pyrazol-1-yl]pyridine |
|---|---|
| PubChem CID | 153366779 |
| Molecular Formula | C12H6Cl4F3N7 |
| Molecular Weight | 447.04 g/mol |
| Exact Mass | 444.94 |
| IUPAC Name | 3-chloro-2-[5-(trichloromethyl)-3-[[5-(trifluoromethyl)tetrazol-2-yl]methyl]pyrazol-1-yl]pyridine |
| SMILES | FC(F)(F)c1nnn(Cc2cc(C(Cl)(Cl)Cl)n(-c3ncccc3Cl)n2)n1 |
| InChI | InChI=1S/C12H6Cl4F3N7/c13-7-2-1-3-20-9(7)26-8(11(14,15)16)4-6(22-26)5-25-23-10(21-24-25)12(17,18)19/h1-4H,5H2 |
| InChIKey | LKTIFGNNHYYJAX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.04 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|