C12H11ClF3N7O — CID 153366826
N,N'-diamino-N-[[1-(3-chloro-2-pyridinyl)-5-formylpyrazol-3-yl]methyl]-2,2,2-trifluoroethanimidamide (PubChem CID 153366826) has the molecular formula C12H11ClF3N7O and a molecular weight of 361.72 g/mol. Its IUPAC name is N,N'-diamino-N-[[1-(3-chloro-2-pyridinyl)-5-formylpyrazol-3-yl]methyl]-2,2,2-trifluoroethanimidamide.
| Compound Name | N,N'-diamino-N-[[1-(3-chloro-2-pyridinyl)-5-formylpyrazol-3-yl]methyl]-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 153366826 |
| Molecular Formula | C12H11ClF3N7O |
| Molecular Weight | 361.72 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | N,N'-diamino-N-[[1-(3-chloro-2-pyridinyl)-5-formylpyrazol-3-yl]methyl]-2,2,2-trifluoroethanimidamide |
| SMILES | N/N=C(\N(N)Cc1cc(C=O)n(-c2ncccc2Cl)n1)C(F)(F)F |
| InChI | InChI=1S/C12H11ClF3N7O/c13-9-2-1-3-19-10(9)23-8(6-24)4-7(21-23)5-22(18)11(20-17)12(14,15)16/h1-4,6H,5,17-18H2/b20-11- |
| InChIKey | SBXFWETVGBJOGG-JAIQZWGSSA-N |
| XLogP | 1.24 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.72 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|