C8H6Cl3F3N4O2 — CID 153366827
(E)-1,1,1-trichloro-4-methoxy-5-[5-(trifluoromethyl)tetrazol-2-yl]pent-3-en-2-one (PubChem CID 153366827) has the molecular formula C8H6Cl3F3N4O2 and a molecular weight of 353.52 g/mol. Its IUPAC name is (E)-1,1,1-trichloro-4-methoxy-5-[5-(trifluoromethyl)tetrazol-2-yl]pent-3-en-2-one.
| Compound Name | (E)-1,1,1-trichloro-4-methoxy-5-[5-(trifluoromethyl)tetrazol-2-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 153366827 |
| Molecular Formula | C8H6Cl3F3N4O2 |
| Molecular Weight | 353.52 g/mol |
| Exact Mass | 351.95 |
| IUPAC Name | (E)-1,1,1-trichloro-4-methoxy-5-[5-(trifluoromethyl)tetrazol-2-yl]pent-3-en-2-one |
| SMILES | CO/C(=C/C(=O)C(Cl)(Cl)Cl)Cn1nnc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H6Cl3F3N4O2/c1-20-4(2-5(19)7(9,10)11)3-18-16-6(15-17-18)8(12,13)14/h2H,3H2,1H3/b4-2+ |
| InChIKey | PSPQXPXPWQSLQX-DUXPYHPUSA-N |
| XLogP | 2.16 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|