C15H16ClF4N3O — CID 153366966
[(3S,4R)-3-fluoropiperidin-4-yl]-[3-(2,3,5-trifluorophenyl)-3,4-dihydropyrazol-2-yl]methanone;hydrochloride (PubChem CID 153366966) has the molecular formula C15H16ClF4N3O and a molecular weight of 365.76 g/mol. Its IUPAC name is [(3S,4R)-3-fluoropiperidin-4-yl]-[3-(2,3,5-trifluorophenyl)-3,4-dihydropyrazol-2-yl]methanone;hydrochloride.
| Compound Name | [(3S,4R)-3-fluoropiperidin-4-yl]-[3-(2,3,5-trifluorophenyl)-3,4-dihydropyrazol-2-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 153366966 |
| Molecular Formula | C15H16ClF4N3O |
| Molecular Weight | 365.76 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | [(3S,4R)-3-fluoropiperidin-4-yl]-[3-(2,3,5-trifluorophenyl)-3,4-dihydropyrazol-2-yl]methanone;hydrochloride |
| SMILES | Cl.O=C([C@H]1CCNC[C@H]1F)N1N=CCC1c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C15H15F4N3O.ClH/c16-8-5-10(14(19)11(17)6-8)13-2-4-21-22(13)15(23)9-1-3-20-7-12(9)18;/h4-6,9,12-13,20H,1-3,7H2;1H/t9-,12+,13?;/m0./s1 |
| InChIKey | IIBODVCBKUNUFF-HTRYBPDISA-N |
| XLogP | 2.73 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.76 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|