C7H11F5OS — CID 153367185
5-ethylsulfinyl-1,1,1,2,2-pentafluoropentane (PubChem CID 153367185) has the molecular formula C7H11F5OS and a molecular weight of 238.22 g/mol. Its IUPAC name is 5-ethylsulfinyl-1,1,1,2,2-pentafluoropentane.
| Compound Name | 5-ethylsulfinyl-1,1,1,2,2-pentafluoropentane |
|---|---|
| PubChem CID | 153367185 |
| Molecular Formula | C7H11F5OS |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 5-ethylsulfinyl-1,1,1,2,2-pentafluoropentane |
| SMILES | CCS(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H11F5OS/c1-2-14(13)5-3-4-6(8,9)7(10,11)12/h2-5H2,1H3 |
| InChIKey | FIQAENDIQODXKE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|