About 7-(2-methylprop-1-enyl)-8-[(Z)-prop-1-enyl]-6-azaspiro[3.4]octa-5,7-dien-5-amine
7-(2-methylprop-1-enyl)-8-[(Z)-prop-1-enyl]-6-azaspiro[3.4]octa-5,7-dien-5-amine (PubChem CID 153367717) has the molecular formula C14H20N2
and a molecular weight of 216.33 g/mol. Its IUPAC name is 7-(2-methylprop-1-enyl)-8-[(Z)-prop-1-enyl]-6-azaspiro[3.4]octa-5,7-dien-5-amine.
Molecular Properties
| Compound Name | 7-(2-methylprop-1-enyl)-8-[(Z)-prop-1-enyl]-6-azaspiro[3.4]octa-5,7-dien-5-amine |
| PubChem CID | 153367717 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 7-(2-methylprop-1-enyl)-8-[(Z)-prop-1-enyl]-6-azaspiro[3.4]octa-5,7-dien-5-amine |
| SMILES | C/C=C\C1=C(C=C(C)C)N=C(N)C12CCC2 |
| InChI | InChI=1S/C14H20N2/c1-4-6-11-12(9-10(2)3)16-13(15)14(11)7-5-8-14/h4,6,9H,5,7-8H2,1-3H3,(H2,15,16)/b6-4- |
| InChIKey | WPCGNYGGGUGRTG-XQRVVYSFSA-N |
| XLogP | 3.32 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(2-methylprop-1-enyl)-8-[(Z)-prop-1-enyl]-6-azaspiro[3.4]octa-5,7-dien-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-methylprop-1-enyl)-8-[(Z)-prop-1-enyl]-6-azaspiro[3.4]octa-5,7-dien-5-amine?
The IUPAC name of 7-(2-methylprop-1-enyl)-8-[(Z)-prop-1-enyl]-6-azaspiro[3.4]octa-5,7-dien-5-amine (CID 153367717) is 7-(2-methylprop-1-enyl)-8-[(Z)-prop-1-enyl]-6-azaspiro[3.4]octa-5,7-dien-5-amine.
What is the SMILES notation for 7-(2-methylprop-1-enyl)-8-[(Z)-prop-1-enyl]-6-azaspiro[3.4]octa-5,7-dien-5-amine?
The canonical SMILES for 7-(2-methylprop-1-enyl)-8-[(Z)-prop-1-enyl]-6-azaspiro[3.4]octa-5,7-dien-5-amine is C/C=C\C1=C(C=C(C)C)N=C(N)C12CCC2.
What is the InChIKey of 7-(2-methylprop-1-enyl)-8-[(Z)-prop-1-enyl]-6-azaspiro[3.4]octa-5,7-dien-5-amine?
The InChIKey is WPCGNYGGGUGRTG-XQRVVYSFSA-N. The full InChI is InChI=1S/C14H20N2/c1-4-6-11-12(9-10(2)3)16-13(15)14(11)7-5-8-14/h4,6,9H,5,7-8H2,1-3H3,(H2,15,16)/b6-4-.
What are the key properties of 7-(2-methylprop-1-enyl)-8-[(Z)-prop-1-enyl]-6-azaspiro[3.4]octa-5,7-dien-5-amine?
7-(2-methylprop-1-enyl)-8-[(Z)-prop-1-enyl]-6-azaspiro[3.4]octa-5,7-dien-5-amine has a molecular weight of 216.33 g/mol, XLogP of 3.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-methylprop-1-enyl)-8-[(Z)-prop-1-enyl]-6-azaspiro[3.4]octa-5,7-dien-5-amine is sourced from PubChem (CID 153367717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).