About 7-butyl-2-(methylamino)-1,9-dihydropurine-6,8-dione
7-butyl-2-(methylamino)-1,9-dihydropurine-6,8-dione (PubChem CID 153368119) has the molecular formula C10H15N5O2
and a molecular weight of 237.26 g/mol. Its IUPAC name is 7-butyl-2-(methylamino)-1,9-dihydropurine-6,8-dione.
Molecular Properties
| Compound Name | 7-butyl-2-(methylamino)-1,9-dihydropurine-6,8-dione |
| PubChem CID | 153368119 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 7-butyl-2-(methylamino)-1,9-dihydropurine-6,8-dione |
| SMILES | CCCCn1c(=O)[nH]c2nc(NC)[nH]c(=O)c21 |
| InChI | InChI=1S/C10H15N5O2/c1-3-4-5-15-6-7(13-10(15)17)12-9(11-2)14-8(6)16/h3-5H2,1-2H3,(H3,11,12,13,14,16,17) |
| InChIKey | ZVJOTKNROGXSMS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-butyl-2-(methylamino)-1,9-dihydropurine-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-butyl-2-(methylamino)-1,9-dihydropurine-6,8-dione?
The IUPAC name of 7-butyl-2-(methylamino)-1,9-dihydropurine-6,8-dione (CID 153368119) is 7-butyl-2-(methylamino)-1,9-dihydropurine-6,8-dione.
What is the SMILES notation for 7-butyl-2-(methylamino)-1,9-dihydropurine-6,8-dione?
The canonical SMILES for 7-butyl-2-(methylamino)-1,9-dihydropurine-6,8-dione is CCCCn1c(=O)[nH]c2nc(NC)[nH]c(=O)c21.
What is the InChIKey of 7-butyl-2-(methylamino)-1,9-dihydropurine-6,8-dione?
The InChIKey is ZVJOTKNROGXSMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O2/c1-3-4-5-15-6-7(13-10(15)17)12-9(11-2)14-8(6)16/h3-5H2,1-2H3,(H3,11,12,13,14,16,17).
What are the key properties of 7-butyl-2-(methylamino)-1,9-dihydropurine-6,8-dione?
7-butyl-2-(methylamino)-1,9-dihydropurine-6,8-dione has a molecular weight of 237.26 g/mol, XLogP of 0.25, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-butyl-2-(methylamino)-1,9-dihydropurine-6,8-dione is sourced from PubChem (CID 153368119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).