C51H40N2 — CID 153369534
N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-9,9-dimethyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]fluoren-1-amine (PubChem CID 153369534) has the molecular formula C51H40N2 and a molecular weight of 680.90 g/mol. Its IUPAC name is N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-9,9-dimethyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]fluoren-1-amine.
| Compound Name | N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-9,9-dimethyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]fluoren-1-amine |
|---|---|
| PubChem CID | 153369534 |
| Molecular Formula | C51H40N2 |
| Molecular Weight | 680.90 g/mol |
| Exact Mass | 680.32 |
| IUPAC Name | N-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-9,9-dimethyl-N-[4-(9-phenylcarbazol-3-yl)phenyl]fluoren-1-amine |
| SMILES | C=C/C=C(\C=C)c1ccc(N(c2ccc(-c3ccc4c(c3)c3ccccc3n4-c3ccccc3)cc2)c2cccc3c2C(C)(C)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C51H40N2/c1-5-15-35(6-2)36-24-29-40(30-25-36)52(49-23-14-20-44-42-18-10-12-21-46(42)51(3,4)50(44)49)41-31-26-37(27-32-41)38-28-33-48-45(34-38)43-19-11-13-22-47(43)53(48)39-16-8-7-9-17-39/h5-34H,1-2H2,3-4H3/b35-15+ |
| InChIKey | KIAUOPUBYWQNNM-PTEHHBOZSA-N |
| XLogP | 13.98 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.90 |
| LogP ≤ 5 | 13.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|