C16H6F6N2O7S2 — CID 153369865
[14-oxo-7-(trifluoromethylsulfonyloxy)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4,6,8(16),9,11-heptaen-5-yl] trifluoromethanesulfonate (PubChem CID 153369865) has the molecular formula C16H6F6N2O7S2 and a molecular weight of 516.35 g/mol. Its IUPAC name is [14-oxo-7-(trifluoromethylsulfonyloxy)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4,6,8(16),9,11-heptaen-5-yl] trifluoromethanesulfonate.
| Compound Name | [14-oxo-7-(trifluoromethylsulfonyloxy)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4,6,8(16),9,11-heptaen-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 153369865 |
| Molecular Formula | C16H6F6N2O7S2 |
| Molecular Weight | 516.35 g/mol |
| Exact Mass | 515.95 |
| IUPAC Name | [14-oxo-7-(trifluoromethylsulfonyloxy)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4,6,8(16),9,11-heptaen-5-yl] trifluoromethanesulfonate |
| SMILES | O=c1[nH]cc2ccc3c(OS(=O)(=O)C(F)(F)F)nc(OS(=O)(=O)C(F)(F)F)c4ccc1c2c34 |
| InChI | InChI=1S/C16H6F6N2O7S2/c17-15(18,19)32(26,27)30-13-8-2-1-6-5-23-12(25)7-3-4-9(11(8)10(6)7)14(24-13)31-33(28,29)16(20,21)22/h1-5H,(H,23,25) |
| InChIKey | DNSCXDRWFSLJPR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 132.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|