About (2E,4E)-N-ethyl-N-prop-2-enyl-4-prop-2-enylsulfanylhexa-2,4-dien-3-amine
(2E,4E)-N-ethyl-N-prop-2-enyl-4-prop-2-enylsulfanylhexa-2,4-dien-3-amine (PubChem CID 153369934) has the molecular formula C14H23NS
and a molecular weight of 237.41 g/mol. Its IUPAC name is (2E,4E)-N-ethyl-N-prop-2-enyl-4-prop-2-enylsulfanylhexa-2,4-dien-3-amine.
Molecular Properties
| Compound Name | (2E,4E)-N-ethyl-N-prop-2-enyl-4-prop-2-enylsulfanylhexa-2,4-dien-3-amine |
| PubChem CID | 153369934 |
| Molecular Formula | C14H23NS |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | (2E,4E)-N-ethyl-N-prop-2-enyl-4-prop-2-enylsulfanylhexa-2,4-dien-3-amine |
| SMILES | C=CCSC(=C/C)/C(=C\C)N(CC)CC=C |
| InChI | InChI=1S/C14H23NS/c1-6-11-15(10-5)13(8-3)14(9-4)16-12-7-2/h6-9H,1-2,10-12H2,3-5H3/b13-8+,14-9+ |
| InChIKey | JTCNCYMISZNPCO-UQNWOCKMSA-N |
| XLogP | 4.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-N-ethyl-N-prop-2-enyl-4-prop-2-enylsulfanylhexa-2,4-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-N-ethyl-N-prop-2-enyl-4-prop-2-enylsulfanylhexa-2,4-dien-3-amine?
The IUPAC name of (2E,4E)-N-ethyl-N-prop-2-enyl-4-prop-2-enylsulfanylhexa-2,4-dien-3-amine (CID 153369934) is (2E,4E)-N-ethyl-N-prop-2-enyl-4-prop-2-enylsulfanylhexa-2,4-dien-3-amine.
What is the SMILES notation for (2E,4E)-N-ethyl-N-prop-2-enyl-4-prop-2-enylsulfanylhexa-2,4-dien-3-amine?
The canonical SMILES for (2E,4E)-N-ethyl-N-prop-2-enyl-4-prop-2-enylsulfanylhexa-2,4-dien-3-amine is C=CCSC(=C/C)/C(=C\C)N(CC)CC=C.
What is the InChIKey of (2E,4E)-N-ethyl-N-prop-2-enyl-4-prop-2-enylsulfanylhexa-2,4-dien-3-amine?
The InChIKey is JTCNCYMISZNPCO-UQNWOCKMSA-N. The full InChI is InChI=1S/C14H23NS/c1-6-11-15(10-5)13(8-3)14(9-4)16-12-7-2/h6-9H,1-2,10-12H2,3-5H3/b13-8+,14-9+.
What are the key properties of (2E,4E)-N-ethyl-N-prop-2-enyl-4-prop-2-enylsulfanylhexa-2,4-dien-3-amine?
(2E,4E)-N-ethyl-N-prop-2-enyl-4-prop-2-enylsulfanylhexa-2,4-dien-3-amine has a molecular weight of 237.41 g/mol, XLogP of 4.22, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-N-ethyl-N-prop-2-enyl-4-prop-2-enylsulfanylhexa-2,4-dien-3-amine is sourced from PubChem (CID 153369934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).