C30H46O — CID 153370594
1-[(1S,3E)-3-[(2E)-2-[(1R)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl]ethanone (PubChem CID 153370594) has the molecular formula C30H46O and a molecular weight of 422.70 g/mol. Its IUPAC name is 1-[(1S,3E)-3-[(2E)-2-[(1R)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl]ethanone.
| Compound Name | 1-[(1S,3E)-3-[(2E)-2-[(1R)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl]ethanone |
|---|---|
| PubChem CID | 153370594 |
| Molecular Formula | C30H46O |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 422.35 |
| IUPAC Name | 1-[(1S,3E)-3-[(2E)-2-[(1R)-1-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl]ethanone |
| SMILES | C=C1CC[C@H](C(C)=O)C/C1=C\C=C1/CCCC2(C)C1CC[C@@H]2[C@H](C)/C=C/[C@H](C)C(C)C |
| InChI | InChI=1S/C30H46O/c1-20(2)21(3)10-11-23(5)28-16-17-29-25(9-8-18-30(28,29)7)14-15-26-19-27(24(6)31)13-12-22(26)4/h10-11,14-15,20-21,23,27-29H,4,8-9,12-13,16-19H2,1-3,5-7H3/b11-10+,25-14+,26-15+/t21-,23+,27-,28+,29?,30?/m0/s1 |
| InChIKey | SGTFNMRSZKISHH-LQXDRIBCSA-N |
| XLogP | 8.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|