About CID 153370969
CID 153370969 (PubChem CID 153370969) has the molecular formula C6H11BFN
and a molecular weight of 126.97 g/mol.
Molecular Properties
| Compound Name | CID 153370969 |
| PubChem CID | 153370969 |
| Molecular Formula | C6H11BFN |
| Molecular Weight | 126.97 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | — |
| SMILES | [B]N(C=C)CCCCF |
| InChI | InChI=1S/C6H11BFN/c1-2-9(7)6-4-3-5-8/h2H,1,3-6H2 |
| InChIKey | PWCSQNLJPAKHIX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.97 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 153370969 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153370969?
The IUPAC name of CID 153370969 (CID 153370969) is not available.
What is the SMILES notation for CID 153370969?
The canonical SMILES for CID 153370969 is [B]N(C=C)CCCCF.
What is the InChIKey of CID 153370969?
The InChIKey is PWCSQNLJPAKHIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11BFN/c1-2-9(7)6-4-3-5-8/h2H,1,3-6H2.
What are the key properties of CID 153370969?
CID 153370969 has a molecular weight of 126.97 g/mol, XLogP of 1.27, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153370969 is sourced from PubChem (CID 153370969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).